ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
99-42-3 Methyl 4-hydroxy-3-nitrobenzoate |
|
| Chemical Name | Methyl 4-hydroxy-3-nitrobenzoate |
| Synonyms | 4-Hydroxy-3-nitrobenzoic acid methyl ester;Methyl 3-nitro-4-hydroxybenzoate;4-(methoxycarbonyl)-2-nitrophenolate;3-nitro-4-hydroxymethyl benzoate |
| Molecular Formula | C8H6NO5 |
| Molecular Weight | 196.1375 |
| InChl | InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
| CAS Registry Number | 99-42-3 |
| EINECS | 202-755-3 |
| Molecular Structure | ![]() |
| Melting Point | 74-76℃ |
| Boiling Point | 311.1°C at 760 mmHg |
| Flash Point | 141.9°C |
| Vapour Pressur | 0.000315mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |