ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
100021-46-3 3-hydroxy-1-(pyridin-3-yl)butan-1-one |
|
| Produkt-Name | 3-hydroxy-1-(pyridin-3-yl)butan-1-one |
| Englischer Name | 3-hydroxy-1-(pyridin-3-yl)butan-1-one; |
| Molekulare Formel | C9H11NO2 |
| Molecular Weight | 165.1891 |
| InChl | InChI=1/C9H11NO2/c1-7(11)5-9(12)8-3-2-4-10-6-8/h2-4,6-7,11H,5H2,1H3 |
| CAS Registry Number | 100021-46-3 |
| Molecular Structure | ![]() |
| Dichte | 1.138g/cm3 |
| Siedepunkt | 332.9°C at 760 mmHg |
| Brechungsindex | 1.534 |
| Flammpunkt | 155.1°C |
| Dampfdruck | 5.63E-05mmHg at 25°C |
| MSDS | |