ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
107610-52-6 3-Methyl-5-(1-methylethyl)2-chlor-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3,5-dicarboxylat |
|
| Produkt-Name | 3-Methyl-5-(1-methylethyl)2-chlor-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridin-3,5-dicarboxylat |
| Englischer Name | 3-methyl 5-(1-methylethyl) 2-chloro-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate; |
| Molekulare Formel | C18H19ClN2O6 |
| Molecular Weight | 394.8063 |
| InChl | InChI=1/C18H19ClN2O6/c1-9(2)27-18(23)13-10(3)20-16(19)15(17(22)26-4)14(13)11-6-5-7-12(8-11)21(24)25/h5-9,14,20H,1-4H3 |
| CAS Registry Number | 107610-52-6 |
| Molecular Structure | ![]() |
| Dichte | 1.35g/cm3 |
| Siedepunkt | 508.5°C at 760 mmHg |
| Brechungsindex | 1.582 |
| Flammpunkt | 261.3°C |
| Dampfdruck | 1.85E-10mmHg at 25°C |
| MSDS | |