ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
110-12-3 5-Methyl-2-hexanone |
|
| Produkt-Name | 5-Methyl-2-hexanone |
| Englischer Name | 5-Methyl-2-hexanone;Methyl isoamyl ketone;Isoamylmethylketone;Isopentyl methyl ketone~Methyl isoamyl ketone~MIAK;Isoamyl methyl ketone;5-methylhexan-2-one;(1R)-2-bromo-1-phenylethanol;MIAK |
| Molekulare Formel | C8H9BrO |
| Molecular Weight | 201.0605 |
| InChl | InChI=1/C8H9BrO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6H2/t8-/m0/s1 |
| CAS Registry Number | 110-12-3 |
| EINECS | 203-737-8 |
| Molecular Structure | ![]() |
| Dichte | 1.504g/cm3 |
| Schmelzpunkt | -74℃ |
| Siedepunkt | 261.634°C at 760 mmHg |
| Brechungsindex | 1.589 |
| Flammpunkt | 135.55°C |
| Wasserlöslichkeit | 5.4 g/L (20℃) |
| Dampfdruck | 0.006mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R10||R20:; |
| Safety Beschreibung | S23||S24/25:; |
| MSDS | |