ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112474-14-3 3-phenoxybenzyl 2-ethyl-3-methylbutanoate |
|
| Produkt-Name | 3-phenoxybenzyl 2-ethyl-3-methylbutanoate |
| Englischer Name | 3-phenoxybenzyl 2-ethyl-3-methylbutanoate; |
| Molekulare Formel | C20H24O3 |
| Molecular Weight | 312.4028 |
| InChl | InChI=1/C20H24O3/c1-4-19(15(2)3)20(21)22-14-16-9-8-12-18(13-16)23-17-10-6-5-7-11-17/h5-13,15,19H,4,14H2,1-3H3 |
| CAS Registry Number | 112474-14-3 |
| Molecular Structure | ![]() |
| Dichte | 1.055g/cm3 |
| Siedepunkt | 401.2°C at 760 mmHg |
| Brechungsindex | 1.531 |
| Flammpunkt | 169.7°C |
| Dampfdruck | 1.2E-06mmHg at 25°C |
| MSDS | |