ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
114-33-0 N-Methylnicotinamide |
|
| Produkt-Name | N-Methylnicotinamide |
| Englischer Name | N-Methylnicotinamide;Methylnicotinamide;N-methylpyridine-3-carboxamide |
| Molekulare Formel | C7H8N2O |
| Molecular Weight | 136.1512 |
| InChl | InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
| CAS Registry Number | 114-33-0 |
| EINECS | 204-046-4 |
| Molecular Structure | ![]() |
| Dichte | 1.106g/cm3 |
| Schmelzpunkt | 100-105℃ |
| Siedepunkt | 347.7°C at 760 mmHg |
| Brechungsindex | 1.529 |
| Flammpunkt | 164.1°C |
| Dampfdruck | 5.3E-05mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |