ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
133472-22-7 3-Phenoxybenzyl (1S,3R)-3-[(Z)-2-chlor-2-furan-2-ylethenyl]-2,2-dimethylcyclopropancarboxylat |
|
| Produkt-Name | 3-Phenoxybenzyl (1S,3R)-3-[(Z)-2-chlor-2-furan-2-ylethenyl]-2,2-dimethylcyclopropancarboxylat |
| Synonyme | ; |
| Englischer Name | 3-phenoxybenzyl (1S,3R)-3-[(Z)-2-chloro-2-furan-2-ylethenyl]-2,2-dimethylcyclopropanecarboxylate; |
| Molekulare Formel | C25H23ClO4 |
| Molecular Weight | 422.9007 |
| InChl | InChI=1/C25H23ClO4/c1-25(2)20(15-21(26)22-12-7-13-28-22)23(25)24(27)29-16-17-8-6-11-19(14-17)30-18-9-4-3-5-10-18/h3-15,20,23H,16H2,1-2H3/b21-15-/t20-,23+/m0/s1 |
| CAS Registry Number | 133472-22-7 |
| Molecular Structure | ![]() |
| Dichte | 1.257g/cm3 |
| Siedepunkt | 520°C at 760 mmHg |
| Brechungsindex | 1.619 |
| Flammpunkt | 268.3°C |
| Dampfdruck | 6.48E-11mmHg at 25°C |
| MSDS | |