ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
173435-34-2 3-Pyridinamine, 2-chloro-4-methoxy- |
|
| Produkt-Name | 3-Pyridinamine, 2-chloro-4-methoxy- |
| Englischer Name | 3-Pyridinamine, 2-chloro-4-methoxy-;2-Chloro-4-methoxypyridin-3-amine;3-pyridinamine, 2-chloro-4-methoxy- |
| Molekulare Formel | C6H7ClN2O |
| Molecular Weight | 158.5856 |
| InChl | InChI=1/C6H7ClN2O/c1-10-4-2-3-9-6(7)5(4)8/h2-3H,8H2,1H3 |
| CAS Registry Number | 173435-34-2 |
| Molecular Structure | ![]() |
| Dichte | 1.311g/cm3 |
| Siedepunkt | 288.6°C at 760 mmHg |
| Brechungsindex | 1.578 |
| Flammpunkt | 128.3°C |
| Dampfdruck | 0.00232mmHg at 25°C |
| MSDS | |