ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
203312-38-3 2-(2,5-dimethylphenyl)-1-hydroxy-8-methoxy-4-azaspiro[4.5]dec-1-en-3-on |
|
| Produkt-Name | 2-(2,5-dimethylphenyl)-1-hydroxy-8-methoxy-4-azaspiro[4.5]dec-1-en-3-on |
| Englischer Name | 2-(2,5-dimethylphenyl)-1-hydroxy-8-methoxy-4-azaspiro[4.5]dec-1-en-3-one; |
| Molekulare Formel | C18H23NO3 |
| Molecular Weight | 301.38 |
| InChl | InChI=1/C18H23NO3/c1-11-4-5-12(2)14(10-11)15-16(20)18(19-17(15)21)8-6-13(22-3)7-9-18/h4-5,10,13,20H,6-9H2,1-3H3,(H,19,21) |
| CAS Registry Number | 203312-38-3 |
| Molecular Structure | ![]() |
| Dichte | 1.2g/cm3 |
| Siedepunkt | 521.4°C at 760 mmHg |
| Brechungsindex | 1.591 |
| Flammpunkt | 269.1°C |
| Dampfdruck | 1.07E-11mmHg at 25°C |
| MSDS | |