ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
206761-79-7 (2R,3R)-2,3-dihydroxy-4-[(4-methylphenyl)amino]-4-oxobutansäure |
|
| Produkt-Name | (2R,3R)-2,3-dihydroxy-4-[(4-methylphenyl)amino]-4-oxobutansäure |
| Synonyme | ;(2R,3R)-2,3-Dihydroxy-4-[(4-methylphenyl)amino]-4-oxobutansäure; Butansäure, 2,3-Dihydroxy-4-[(4-methylphenyl)amino]-4-oxo-, (2R,3R)-; |
| Englischer Name | (2R,3R)-2,3-dihydroxy-4-[(4-methylphenyl)amino]-4-oxobutanoic acid;(2R,3R)-2,3-Dihydroxy-4-[(4-methylphenyl)amino]-4-oxobutanoic acid;Butanoic acid, 2,3-dihydroxy-4-[(4-methylphenyl)amino]-4-oxo-, (2R,3R)- |
| Molekulare Formel | C11H13NO5 |
| Molecular Weight | 239.2246 |
| InChl | InChI=1/C11H13NO5/c1-6-2-4-7(5-3-6)12-10(15)8(13)9(14)11(16)17/h2-5,8-9,13-14H,1H3,(H,12,15)(H,16,17)/t8-,9-/m1/s1 |
| CAS Registry Number | 206761-79-7 |
| Molecular Structure | ![]() |
| Dichte | 1.474g/cm3 |
| Siedepunkt | 576.3°C at 760 mmHg |
| Brechungsindex | 1.65 |
| Flammpunkt | 302.3°C |
| Dampfdruck | 4.03E-14mmHg at 25°C |
| MSDS | |