ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207740-18-9 2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamin |
|
| Produkt-Name | 2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamin |
| Synonyme | ; 2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamin; Benzolethanamin, 2,5-dimethoxy-3,4-dimethyl- |
| Englischer Name | 2-(2,5-dimethoxy-3,4-dimethyl-phenyl)ethanamine;2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamine;benzeneethanamine, 2,5-dimethoxy-3,4-dimethyl- |
| Molekulare Formel | C12H19NO2 |
| Molecular Weight | 209.2848 |
| InChl | InChI=1/C12H19NO2/c1-8-9(2)12(15-4)10(5-6-13)7-11(8)14-3/h7H,5-6,13H2,1-4H3 |
| CAS Registry Number | 207740-18-9 |
| Molecular Structure | ![]() |
| Dichte | 1.013g/cm3 |
| Siedepunkt | 321.5°C at 760 mmHg |
| Brechungsindex | 1.515 |
| Flammpunkt | 162.1°C |
| Dampfdruck | 0.000298mmHg at 25°C |
| MSDS | |