ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
209256-41-7 2,3-Dihydro-1-benzofuran-4-ylmethanol |
|
| Produkt-Name | 2,3-Dihydro-1-benzofuran-4-ylmethanol |
| Englischer Name | 2,3-dihydro-1-benzofuran-4-ylmethanol; |
| Molekulare Formel | C9H10O2 |
| Molecular Weight | 150.1745 |
| InChl | InChI=1/C9H10O2/c10-6-7-2-1-3-9-8(7)4-5-11-9/h1-3,10H,4-6H2 |
| CAS Registry Number | 209256-41-7 |
| Molecular Structure | ![]() |
| Dichte | 1.217g/cm3 |
| Siedepunkt | 282.1°C at 760 mmHg |
| Brechungsindex | 1.594 |
| Flammpunkt | 132.8°C |
| Dampfdruck | 0.00162mmHg at 25°C |
| MSDS | |