ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216143-90-7 Ethyl 5-acetyl-2-ethoxybenzoate |
|
Produkt-Name | Ethyl 5-acetyl-2-ethoxybenzoate |
Englischer Name | Ethyl 5-acetyl-2-ethoxybenzoate;4-Ethoxy-3-ethoxycarbonyl acetophenone |
Molekulare Formel | C13H16O4 |
Molecular Weight | 236.2637 |
InChl | InChI=1/C13H16O4/c1-4-16-12-7-6-10(9(3)14)8-11(12)13(15)17-5-2/h6-8H,4-5H2,1-3H3 |
CAS Registry Number | 216143-90-7 |
Molecular Structure | ![]() |
Dichte | 1.094g/cm3 |
Siedepunkt | 362.7°C at 760 mmHg |
Brechungsindex | 1.504 |
Flammpunkt | 160°C |
Dampfdruck | 1.89E-05mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |