ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
219783-74-1 2,3-Dimethylbenzohydrazid |
|
| Produkt-Name | 2,3-Dimethylbenzohydrazid |
| Englischer Name | 2,3-dimethylbenzohydrazide; |
| Molekulare Formel | C9H12N2O |
| Molecular Weight | 164.2044 |
| InChl | InChI=1/C9H12N2O/c1-6-4-3-5-8(7(6)2)9(12)11-10/h3-5H,10H2,1-2H3,(H,11,12) |
| CAS Registry Number | 219783-74-1 |
| Molecular Structure | ![]() |
| Dichte | 1.098g/cm3 |
| Brechungsindex | 1.561 |
| MSDS | |