ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
219998-30-8 2,4,6-Trifluoroanisole |
|
| Produkt-Name | 2,4,6-Trifluoroanisole |
| Englischer Name | 2,4,6-Trifluoroanisole;1,3,5-Trifluoro-2-methoxybenzene;2,4,6-Trifluoroanisole;Benzene, 1,3,5-trifluoro-2-methoxy-;FR CF EF BO1;Methyl 2,4,6-trifluorophenyl ether |
| Molekulare Formel | C7H5F3O |
| Molecular Weight | 162.1092 |
| InChl | InChI=1/C7H5F3O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3 |
| CAS Registry Number | 219998-30-8 |
| Molecular Structure | ![]() |
| Dichte | 1.285g/cm3 |
| Siedepunkt | 158.6°C at 760 mmHg |
| Brechungsindex | 1.435 |
| Flammpunkt | 55.8°C |
| Dampfdruck | 3.38mmHg at 25°C |
| MSDS | |