ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2243-82-5 Naphthalene-2-carboxamide |
|
Produkt-Name | Naphthalene-2-carboxamide |
Englischer Name | Naphthalene-2-carboxamide;2-Naphthylamide |
Molekulare Formel | C11H9NO |
Molecular Weight | 171.1953 |
InChl | InChI=1/C11H9NO/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H2,12,13) |
CAS Registry Number | 2243-82-5 |
EINECS | 218-820-4 |
Molecular Structure | ![]() |
Dichte | 1.203g/cm3 |
Siedepunkt | 401.5°C at 760 mmHg |
Brechungsindex | 1.668 |
Flammpunkt | 196.6°C |
Dampfdruck | 1.18E-06mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |