ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22483-52-9 Isophthalsäure, Dianhydrid mit Diethylbis(hydrogencarbonat) |
|
Produkt-Name | Isophthalsäure, Dianhydrid mit Diethylbis(hydrogencarbonat) |
Synonyme | Isophthalsäure, Dianhydrid mit Diethylbis(hydrogencarbonat); Benzol-1,3-diyldicarbonyldiethylbiscarbonat; |
Englischer Name | isophthalic acid, dianhydride with diethyl bis(hydrogen carbonate);Isophthalic acid, dianhydride with diethyl bis(hydrogen carbonate);benzene-1,3-diyldicarbonyl diethyl biscarbonate |
Molekulare Formel | C14H14O8 |
Molecular Weight | 310.2562 |
InChl | InChI=1/C14H14O8/c1-3-19-13(17)21-11(15)9-6-5-7-10(8-9)12(16)22-14(18)20-4-2/h5-8H,3-4H2,1-2H3 |
CAS Registry Number | 22483-52-9 |
EINECS | 245-027-0 |
Molecular Structure | ![]() |
Dichte | 1.302g/cm3 |
Siedepunkt | 419.4°C at 760 mmHg |
Brechungsindex | 1.515 |
Flammpunkt | 185.5°C |
Dampfdruck | 3.05E-07mmHg at 25°C |
MSDS |