ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
230-27-3 7,8-Benzoquinoline |
|
| Produkt-Name | 7,8-Benzoquinoline |
| Englischer Name | 7,8-Benzoquinoline;alpha-Naphthoquinoline;4-Azaphenanthrene;Benzo[h]quinoline;7,8-Benzoquinoline~alpha-Naphthoquinoline;benzo(h)quinoline;alpha-Benzoquinoline;α-naphthoquinoline |
| Molekulare Formel | C13H9N |
| Molecular Weight | 179.22 |
| InChl | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| CAS Registry Number | 230-27-3 |
| EINECS | 205-937-0 |
| Molecular Structure | ![]() |
| Schmelzpunkt | 48-50℃ |
| Siedepunkt | 338℃ (719 mmHg) |
| Flammpunkt | 113℃ |
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S22||S24/25:; |
| MSDS | |