ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
263385-59-7 3-Methyl-5-(4-methyl-1,2,3-thiadiazol-5-yl)isoxazol-4-carbonsäure | 
    |
| Produkt-Name | 3-Methyl-5-(4-methyl-1,2,3-thiadiazol-5-yl)isoxazol-4-carbonsäure | 
| Englischer Name | 3-methyl-5-(4-methyl-1,2,3-thiadiazol-5-yl)isoxazole-4-carboxylic acid; | 
| Molekulare Formel | C8H7N3O3S | 
| Molecular Weight | 225.2245 | 
| InChl | InChI=1/C8H7N3O3S/c1-3-5(8(12)13)6(14-10-3)7-4(2)9-11-15-7/h1-2H3,(H,12,13) | 
| CAS Registry Number | 263385-59-7 | 
| Molecular Structure | ![]()  | 
    
| Dichte | 1.484g/cm3 | 
| Schmelzpunkt | 224℃ | 
| Siedepunkt | 388°C at 760 mmHg | 
| Brechungsindex | 1.606 | 
| Flammpunkt | 188.5°C | 
| Dampfdruck | 1.02E-06mmHg at 25°C | 
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; | 
    
| MSDS | |