Chemindex > 2755-26-2
DE ▼
2755-26-2 (R)-12-hydroxyoleic acid, compound with 2,2',2''-nitrilotriethanol (1:1) |
|
| Produkt-Name | (R)-12-hydroxyoleic acid, compound with 2,2',2''-nitrilotriethanol (1:1) |
| Englischer Name | (R)-12-hydroxyoleic acid, compound with 2,2',2''-nitrilotriethanol (1:1);Ricinoleic acid, triethanolamine salt;(R)-12-Hydroxyoleic acid, compound with 2,2',2''-nitrilotriethanol(1:1);9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);(9Z)-12-hydroxyoctadec-9-enoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Molekulare Formel | C24H49NO6 |
| Molecular Weight | 447.649 |
| InChl | InChI=1/C18H34O3.C6H15NO3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;8-4-1-7(2-5-9)3-6-10/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);8-10H,1-6H2/b12-9-; |
| CAS Registry Number | 2755-26-2 |
| EINECS | 220-408-4 |
| Molecular Structure |  |
| Siedepunkt | 416.4°C at 760 mmHg |
| Flammpunkt | 219.8°C |
| Dampfdruck | 1.12E-08mmHg at 25°C |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 2755-26-2 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 