ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28164-39-8 2-bromo-4-(1H-inden-1-ylidenemethyl)-N,N-dimethylaniline |
|
| Produkt-Name | 2-bromo-4-(1H-inden-1-ylidenemethyl)-N,N-dimethylaniline |
| Englischer Name | 2-bromo-4-(1H-inden-1-ylidenemethyl)-N,N-dimethylaniline; |
| Molekulare Formel | C18H16BrN |
| Molecular Weight | 326.2303 |
| InChl | InChI=1/C18H16BrN/c1-20(2)18-10-7-13(12-17(18)19)11-15-9-8-14-5-3-4-6-16(14)15/h3-12H,1-2H3 |
| CAS Registry Number | 28164-39-8 |
| Molecular Structure | ![]() |
| Dichte | 1.395g/cm3 |
| Siedepunkt | 449.7°C at 760 mmHg |
| Brechungsindex | 1.703 |
| Flammpunkt | 225.8°C |
| Dampfdruck | 2.81E-08mmHg at 25°C |
| MSDS | |