Chemindex > 29868-01-7
DE ▼
29868-01-7 Apfelsäure, Verbindung mit 2-Aminoethanol |
|
| Produkt-Name | Apfelsäure, Verbindung mit 2-Aminoethanol |
| Synonyme | Butandisäure, 2-Hydroxy-, vereinigt mit 2-Aminoethanol (1:?); Butandisäure, Hydroxy-, kompd.mit 2-Aminoethanol; Apfelsäure, komp.u. 2-Aminoethanol; Apfelsäure, Verbindung mit 2-Aminoethanol; 2-Hydroxybutandisäure-2-Aminoethanol (1:1); |
| Englischer Name | malic acid, compound with 2-aminoethanol;Butanedioic acid, 2-hydroxy-, compd. with 2-aminoethanol (1:?);Butanedioic acid, hydroxy-, compd. with 2-aminoethanol;Malic acid, compd. with 2-aminoethanol;Malic acid, compound with 2-aminoethanol;2-hydroxybutanedioic acid - 2-aminoethanol (1:1) |
| Molekulare Formel | C6H13NO6 |
| Molecular Weight | 195.1705 |
| InChl | InChI=1/C4H6O5.C2H7NO/c5-2(4(8)9)1-3(6)7;3-1-2-4/h2,5H,1H2,(H,6,7)(H,8,9);4H,1-3H2 |
| CAS Registry Number | 29868-01-7 |
| EINECS | 249-903-3 |
| Molecular Structure |  |
| Siedepunkt | 306.4°C at 760 mmHg |
| Flammpunkt | 153.4°C |
| Dampfdruck | 7.19E-05mmHg at 25°C |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Lieferanten für 29868-01-7 (0):
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 