ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
300-85-6 DL-3-Hydroxy-n-butyric Acid |
|
| Produkt-Name | DL-3-Hydroxy-n-butyric Acid |
| Englischer Name | DL-3-Hydroxy-n-butyric Acid;3-Hydroxybutyric acid;dl-B-hydroxybutyric acid;(3R)-3-hydroxybutanoate;DL-3-Hydroxybutanoic acid |
| Molekulare Formel | C4H8O3 |
| Molecular Weight | 104.1 |
| InChl | InChI=1/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/p-1/t3-/m1/s1 |
| CAS Registry Number | 300-85-6;625-71-8 |
| Molecular Structure | ![]() |
| Dichte | 1.126 |
| Siedepunkt | 118-120℃ (2 mmHg) |
| Brechungsindex | 1.443 |
| Flammpunkt | >110℃ |
| Dampfdruck | 0.000979mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |