ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3033-82-7 8-Chloroquinaldine |
|
Produkt-Name | 8-Chloroquinaldine |
Englischer Name | 8-Chloroquinaldine;8-Chloro-2-methylquinoline;2-Methyl-8-chloroquinoline |
Molekulare Formel | C10H8ClN |
Molecular Weight | 177.6302 |
InChl | InChI=1/C10H8ClN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3 |
CAS Registry Number | 3033-82-7 |
Molecular Structure | ![]() |
Dichte | 1.225g/cm3 |
Schmelzpunkt | 64-66℃ |
Siedepunkt | 278.2°C at 760 mmHg |
Brechungsindex | 1.634 |
Flammpunkt | 148.7°C |
Dampfdruck | 0.00732mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |