ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-75-1 4-(1-Naphthylamino)-4-oxobut-2-ensäure |
|
| Produkt-Name | 4-(1-Naphthylamino)-4-oxobut-2-ensäure |
| Synonyme | 4-(Naphthalin-1-ylamino)-4-oxobut-2-ensäure; (2E)-4-(Naphthalin-1-ylamino)-4-oxobut-2-ensäure; |
| Englischer Name | 4-(1-naphthylamino)-4-oxobut-2-enoic acid;4-(naphthalen-1-ylamino)-4-oxobut-2-enoic acid;(2E)-4-(naphthalen-1-ylamino)-4-oxobut-2-enoic acid |
| Molekulare Formel | C14H11NO3 |
| Molecular Weight | 241.242 |
| InChl | InChI=1/C14H11NO3/c16-13(8-9-14(17)18)15-12-7-3-5-10-4-1-2-6-11(10)12/h1-9H,(H,15,16)(H,17,18)/b9-8+ |
| CAS Registry Number | 306935-75-1 |
| Molecular Structure | ![]() |
| Dichte | 1.356g/cm3 |
| Schmelzpunkt | 150℃ |
| Siedepunkt | 533.9°C at 760 mmHg |
| Brechungsindex | 1.706 |
| Flammpunkt | 276.7°C |
| Dampfdruck | 3.15E-12mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |