ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
328556-89-4 5-(3-methyl-2-nitrophenyl)-4-(2-methylprop-2-en-1-yl)-2,4-dihydro-3H-1,2,4-triazol-3-thion |
|
| Produkt-Name | 5-(3-methyl-2-nitrophenyl)-4-(2-methylprop-2-en-1-yl)-2,4-dihydro-3H-1,2,4-triazol-3-thion |
| Synonyme | ; |
| Englischer Name | 5-(3-methyl-2-nitrophenyl)-4-(2-methylprop-2-en-1-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione; |
| Molekulare Formel | C13H14N4O2S |
| Molecular Weight | 290.3409 |
| InChl | InChI=1/C13H14N4O2S/c1-8(2)7-16-12(14-15-13(16)20)10-6-4-5-9(3)11(10)17(18)19/h4-6H,1,7H2,2-3H3,(H,15,20) |
| CAS Registry Number | 328556-89-4 |
| Molecular Structure | ![]() |
| Dichte | 1.34g/cm3 |
| Siedepunkt | 409.3°C at 760 mmHg |
| Brechungsindex | 1.659 |
| Flammpunkt | 201.4°C |
| Dampfdruck | 6.54E-07mmHg at 25°C |
| MSDS | |