ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
329715-35-7 4-(1,3-dihydro-2H-isoindol-2-yl)benzoesäure |
|
| Produkt-Name | 4-(1,3-dihydro-2H-isoindol-2-yl)benzoesäure |
| Synonyme | 4-(1,3-Dihydro-2H-isoindol-2-yl)benzoesäure; Benzoesäure, 4-(1,3-dihydro-2H-isoindol-2-yl)-; |
| Englischer Name | 4-(1,3-dihydro-2H-isoindol-2-yl)benzoic acid;4-(1,3-Dihydro-2H-isoindol-2-yl)benzoic acid;Benzoic acid, 4-(1,3-dihydro-2H-isoindol-2-yl)- |
| Molekulare Formel | C15H13NO2 |
| Molecular Weight | 239.2692 |
| InChl | InChI=1/C15H13NO2/c17-15(18)11-5-7-14(8-6-11)16-9-12-3-1-2-4-13(12)10-16/h1-8H,9-10H2,(H,17,18) |
| CAS Registry Number | 329715-35-7 |
| Molecular Structure | ![]() |
| Dichte | 1.284g/cm3 |
| Siedepunkt | 460.5°C at 760 mmHg |
| Brechungsindex | 1.659 |
| Flammpunkt | 232.3°C |
| Dampfdruck | 2.81E-09mmHg at 25°C |
| MSDS | |