ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332390-97-3 4-[(5R)-5-(4-methoxyphenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazol-1-yl]-4-oxobutanoat |
|
| Produkt-Name | 4-[(5R)-5-(4-methoxyphenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazol-1-yl]-4-oxobutanoat |
| Synonyme | ; |
| Englischer Name | 4-[(5R)-5-(4-methoxyphenyl)-3-thiophen-2-yl-4,5-dihydro-1H-pyrazol-1-yl]-4-oxobutanoate; |
| Molekulare Formel | C18H17N2O4S |
| Molecular Weight | 357.4041 |
| InChl | InChI=1/C18H18N2O4S/c1-24-13-6-4-12(5-7-13)15-11-14(16-3-2-10-25-16)19-20(15)17(21)8-9-18(22)23/h2-7,10,15H,8-9,11H2,1H3,(H,22,23)/p-1/t15-/m1/s1 |
| CAS Registry Number | 332390-97-3 |
| Molecular Structure | ![]() |
| Siedepunkt | 567.6°C at 760 mmHg |
| Flammpunkt | 297.1°C |
| Dampfdruck | 1.01E-13mmHg at 25°C |
| MSDS | |