ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
338454-30-1 4-Benzyloxy-3-methylphenylboronic acid |
|
| Produkt-Name | 4-Benzyloxy-3-methylphenylboronic acid |
| Englischer Name | 4-Benzyloxy-3-methylphenylboronic acid;(4-Benzyloxy-3-methylphenyl)boronic acid; 4-Benzyloxy-3-methylbenzeneboronic acid |
| Molekulare Formel | C14H15BO3 |
| Molecular Weight | 242.0781 |
| InChl | InChI=1/C14H15BO3/c1-11-9-13(15(16)17)7-8-14(11)18-10-12-5-3-2-4-6-12/h2-9,16-17H,10H2,1H3 |
| CAS Registry Number | 338454-30-1 |
| Molecular Structure | ![]() |
| Dichte | 1.178g/cm3 |
| Siedepunkt | 431.597°C at 760 mmHg |
| Brechungsindex | 1.586 |
| Flammpunkt | 214.822°C |
| Dampfdruck | 0mmHg at 25°C |
| MSDS | |