ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
342405-19-0 4-Iod-5-methyl-1-phenyl-1H-pyrazol |
|
| Produkt-Name | 4-Iod-5-methyl-1-phenyl-1H-pyrazol |
| Englischer Name | 4-iodo-5-methyl-1-phenyl-1H-pyrazole; |
| Molekulare Formel | C10H9IN2 |
| Molecular Weight | 284.0963 |
| InChl | InChI=1/C10H9IN2/c1-8-10(11)7-12-13(8)9-5-3-2-4-6-9/h2-7H,1H3 |
| CAS Registry Number | 342405-19-0 |
| Molecular Structure | ![]() |
| Dichte | 1.68g/cm3 |
| Schmelzpunkt | 65℃ |
| Siedepunkt | 332.8°C at 760 mmHg |
| Brechungsindex | 1.669 |
| Flammpunkt | 155°C |
| Dampfdruck | 0.000276mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |