ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
351982-40-6 4-[4-(1-methylpropyl)phenyl]-1,3-thiazol-2-amin |
|
| Produkt-Name | 4-[4-(1-methylpropyl)phenyl]-1,3-thiazol-2-amin |
| Synonyme | 2-Thiazolamin, 4-[4-(1-methylpropyl)phenyl]-; 4-(4-sec-Butylphenyl)-1,3-thiazol-2-amin; 4-(4-sec-butylphenyl)-1,3-thiazol-2-ylamin; 4-(4-sec-Butylphenyl)-thiazol-2-ylamin; |
| Englischer Name | 4-[4-(1-methylpropyl)phenyl]-1,3-thiazol-2-amine;2-Thiazolamine, 4-[4-(1-methylpropyl)phenyl]-;4-(4-sec-Butylphenyl)-1,3-thiazol-2-amine;4-(4-sec-butylphenyl)-1,3-thiazol-2-ylamine;4-(4-sec-Butyl-phenyl)-thiazol-2-ylamine |
| Molekulare Formel | C13H16N2S |
| Molecular Weight | 232.3445 |
| InChl | InChI=1/C13H16N2S/c1-3-9(2)10-4-6-11(7-5-10)12-8-16-13(14)15-12/h4-9H,3H2,1-2H3,(H2,14,15) |
| CAS Registry Number | 351982-40-6 |
| Molecular Structure | ![]() |
| Dichte | 1.126g/cm3 |
| Siedepunkt | 386°C at 760 mmHg |
| Brechungsindex | 1.597 |
| Flammpunkt | 187.3°C |
| Dampfdruck | 3.65E-06mmHg at 25°C |
| MSDS | |