ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
365542-45-6 4-[2-[4-[2-methoxy-5-[2-(4-chinolyl)ethyl]phenoxy]phenyl]ethyl]chinolin-dihydrochlorid |
|
| Produkt-Name | 4-[2-[4-[2-methoxy-5-[2-(4-chinolyl)ethyl]phenoxy]phenyl]ethyl]chinolin-dihydrochlorid |
| Englischer Name | 4-[2-[4-[2-methoxy-5-[2-(4-quinolyl)ethyl]phenoxy]phenyl]ethyl]quinoline dihydrochloride; |
| Molekulare Formel | C35H32Cl2N2O2 |
| Molecular Weight | 583.5468 |
| InChl | InChI=1/C35H30N2O2.2ClH/c1-38-34-19-14-26(11-16-28-21-23-37-33-9-5-3-7-31(28)33)24-35(34)39-29-17-12-25(13-18-29)10-15-27-20-22-36-32-8-4-2-6-30(27)32;;/h2-9,12-14,17-24H,10-11,15-16H2,1H3;2*1H |
| CAS Registry Number | 365542-45-6 |
| Molecular Structure | ![]() |
| MSDS | |