ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
366452-97-3 4-nitroisoindolin-1-one |
|
| Produkt-Name | 4-nitroisoindolin-1-one |
| Englischer Name | 4-nitroisoindolin-1-one;4-nitro-2,3-dihydro-1H-isoindol-1-one;1H-Isoindol-1-one, 2,3-dihydro-4-nitro- |
| Molekulare Formel | C8H6N2O3 |
| Molecular Weight | 178.1448 |
| InChl | InChI=1/C8H6N2O3/c11-8-5-2-1-3-7(10(12)13)6(5)4-9-8/h1-3H,4H2,(H,9,11) |
| CAS Registry Number | 366452-97-3 |
| Molecular Structure | ![]() |
| Dichte | 1.45g/cm3 |
| Siedepunkt | 488.773°C at 760 mmHg |
| Brechungsindex | 1.632 |
| Flammpunkt | 249.401°C |
| Dampfdruck | 0mmHg at 25°C |
| MSDS | |