ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368870-03-5 4-(1H-pyrazol-1-yl)benzylamine |
|
| Produkt-Name | 4-(1H-pyrazol-1-yl)benzylamine |
| Englischer Name | 4-(1H-pyrazol-1-yl)benzylamine;1-[4-(1H-pyrazol-1-yl)phenyl]methanamine;4-(Pyrazol-1-yl)benzylamine |
| Molekulare Formel | C10H11N3 |
| Molecular Weight | 173.2144 |
| InChl | InChI=1/C10H11N3/c11-8-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H,8,11H2 |
| CAS Registry Number | 368870-03-5 |
| Molecular Structure | ![]() |
| Dichte | 1.16g/cm3 |
| Schmelzpunkt | 94℃ |
| Siedepunkt | 307.1°C at 760 mmHg |
| Brechungsindex | 1.622 |
| Flammpunkt | 139.6°C |
| Dampfdruck | 0.000738mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R34##Causes burns.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |