ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
389602-90-8 4-(1,4-dioxaspiro[4.5]decan-8-yl)anilin |
|
| Produkt-Name | 4-(1,4-dioxaspiro[4.5]decan-8-yl)anilin |
| Synonyme | ; 4-(1,4-Dioxaspiro[4,5]dec-8-yl)benzonamin; 4-(1,4-Dioxaspiro[4.5]dec-8-yl)anilin; Benzolamin, 4-(1,4-dioxaspiro[4.5]dec-8-yl)- |
| Englischer Name | 4-(1,4-dioxaspiro[4.5]decan-8-yl)aniline;4-(1,4-Dioxaspiro[4,5]dec-8-yl) benzenamine;4-(1,4-Dioxaspiro[4.5]dec-8-yl)aniline;benzenamine, 4-(1,4-dioxaspiro[4.5]dec-8-yl)- |
| Molekulare Formel | C14H19NO2 |
| Molecular Weight | 233.3062 |
| InChl | InChI=1/C14H19NO2/c15-13-3-1-11(2-4-13)12-5-7-14(8-6-12)16-9-10-17-14/h1-4,12H,5-10,15H2 |
| CAS Registry Number | 389602-90-8 |
| Molecular Structure | ![]() |
| Dichte | 1.16g/cm3 |
| Siedepunkt | 396.5°C at 760 mmHg |
| Brechungsindex | 1.58 |
| Flammpunkt | 213.4°C |
| Dampfdruck | 1.71E-06mmHg at 25°C |
| MSDS | |