ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
40101-17-5 m-Anisil |
|
Produkt-Name | m-Anisil |
Englischer Name | m-Anisil;3,3-Dimethoxybenzil;3,3-Dimethoxydibenzoyl;1,2-bis(3-methoxyphenyl)ethane-1,2-dione |
Molekulare Formel | C16H14O4 |
Molecular Weight | 270.28 |
InChl | InChI=1/C16H14O4/c1-19-13-7-3-5-11(9-13)15(17)16(18)12-6-4-8-14(10-12)20-2/h3-10H,1-2H3 |
CAS Registry Number | 40101-17-5 |
EINECS | 254-793-5 |
Molecular Structure | ![]() |
Dichte | 1.183g/cm3 |
Siedepunkt | 442.2°C at 760 mmHg |
Brechungsindex | 1.566 |
Flammpunkt | 197.5°C |
Dampfdruck | 5.13E-08mmHg at 25°C |
Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |