ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
436088-83-4 Methyl-3-amino-5-fluor-1H-indol-2-carboxylat |
|
| Produkt-Name | Methyl-3-amino-5-fluor-1H-indol-2-carboxylat |
| Synonyme | 1H-Indol-2-carbonsäure, 3-Amino-5-fluor-, methylester; 3-Amino-5-fluor-1H-indol-2-carbonsäuremethylester; Methyl-3-amino-5-fluor-1H-indol-2-carboxylat; |
| Englischer Name | methyl 3-amino-5-fluoro-1H-indole-2-carboxylate;1H-Indole-2-carboxylic acid, 3-amino-5-fluoro-, methyl ester;3-Amino-5-fluoro-1H-indole-2-carboxylic acid methyl ester;Methyl 3-amino-5-fluoro-1H-indole-2-carboxylate |
| Molekulare Formel | C10H9FN2O2 |
| Molecular Weight | 208.1891 |
| InChl | InChI=1/C10H9FN2O2/c1-15-10(14)9-8(12)6-4-5(11)2-3-7(6)13-9/h2-4,13H,12H2,1H3 |
| CAS Registry Number | 436088-83-4 |
| Molecular Structure | ![]() |
| Dichte | 1.423g/cm3 |
| Siedepunkt | 396.5°C at 760 mmHg |
| Brechungsindex | 1.668 |
| Flammpunkt | 193.6°C |
| Dampfdruck | 1.7E-06mmHg at 25°C |
| MSDS | |