ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
452-64-2 1,2-Dimethyl-4-fluorobenzene |
|
| Produkt-Name | 1,2-Dimethyl-4-fluorobenzene |
| Englischer Name | 1,2-Dimethyl-4-fluorobenzene;Fluoroxylene2;Fluorooxylene;3,4-Dimethylfluorobenzene;4-(Trifluoromethyl)-o-xylene;4-fluoro-1,2-dimethylbenzene;1-fluoro-2,4-dimethylbenzene;4-Fluoro-o-xylene |
| Molekulare Formel | C8H9F |
| Molecular Weight | 124.1555 |
| InChl | InChI=1/C8H9F/c1-6-3-4-8(9)7(2)5-6/h3-5H,1-2H3 |
| CAS Registry Number | 452-64-2 |
| Molecular Structure | ![]() |
| Dichte | 0.984g/cm3 |
| Siedepunkt | 144.62°C at 760 mmHg |
| Brechungsindex | 1.481 |
| Flammpunkt | 30.873°C |
| Dampfdruck | 6.357mmHg at 25°C |
| Gefahrensymbole | |
| Risk Codes | R10##Flammable.:; |
| Safety Beschreibung | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |