ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
495-69-2 Hippuric acid |
|
Produkt-Name | Hippuric acid |
Englischer Name | Hippuric acid;N-Benzoylglycine;[(phenylcarbonyl)amino]acetate;2-benzamidoacetic acid;Bz-Gly-OH |
Molekulare Formel | C9H8NO3 |
Molecular Weight | 178.1653 |
InChl | InChI=1/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12)/p-1 |
CAS Registry Number | 495-69-2;21251-67-2;66407-11-2;140480-84-8;892119-18-5;892119-19-6 |
EINECS | 207-806-3 |
Molecular Structure | ![]() |
Schmelzpunkt | 188-191℃ |
Siedepunkt | 464.1°C at 760 mmHg |
Flammpunkt | 234.5°C |
Dampfdruck | 2.06E-09mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |