ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
49612-12-6 4-hydrazino-6-methoxy-2-methylquinoline |
|
| Produkt-Name | 4-hydrazino-6-methoxy-2-methylquinoline |
| Englischer Name | 4-hydrazino-6-methoxy-2-methylquinoline;4-Hydrazino-6-methoxy-2-methylquinoline;quinoline, 4-hydrazinyl-6-methoxy-2-methyl- |
| Molekulare Formel | C11H13N3O |
| Molecular Weight | 203.2404 |
| InChl | InChI=1/C11H13N3O/c1-7-5-11(14-12)9-6-8(15-2)3-4-10(9)13-7/h3-6H,12H2,1-2H3,(H,13,14) |
| CAS Registry Number | 49612-12-6 |
| Molecular Structure | ![]() |
| Dichte | 1.241g/cm3 |
| Siedepunkt | 395.7°C at 760 mmHg |
| Brechungsindex | 1.684 |
| Flammpunkt | 193.1°C |
| Dampfdruck | 1.81E-06mmHg at 25°C |
| MSDS | |