ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone |
|
Produkt-Name | 4-Hydroxy-6-methyl-3-nitro-2-pyridone |
Englischer Name | 4-Hydroxy-6-methyl-3-nitro-2-pyridone;2-hydroxy-6-methyl-3-nitropyridin-4(1H)-one |
Molekulare Formel | C6H6N2O4 |
Molecular Weight | 170.1228 |
InChl | InChI=1/C6H6N2O4/c1-3-2-4(9)5(8(11)12)6(10)7-3/h2H,1H3,(H2,7,9,10) |
CAS Registry Number | 4966-90-9 |
Molecular Structure | ![]() |
Dichte | 1.53g/cm3 |
Schmelzpunkt | 293-296℃ |
Siedepunkt | 265.6°C at 760 mmHg |
Brechungsindex | 1.608 |
Flammpunkt | 114.4°C |
Dampfdruck | 0.00125mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |