ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50673-55-7 4-(1-Biphenyl-4-ylpropoxy)-4-oxobutansäure |
|
| Produkt-Name | 4-(1-Biphenyl-4-ylpropoxy)-4-oxobutansäure |
| Englischer Name | 4-(1-biphenyl-4-ylpropoxy)-4-oxobutanoic acid; |
| Molekulare Formel | C19H20O4 |
| Molecular Weight | 312.3597 |
| InChl | InChI=1/C19H20O4/c1-2-17(23-19(22)13-12-18(20)21)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11,17H,2,12-13H2,1H3,(H,20,21) |
| CAS Registry Number | 50673-55-7 |
| Molecular Structure | ![]() |
| Dichte | 1.161g/cm3 |
| Siedepunkt | 487.6°C at 760 mmHg |
| Brechungsindex | 1.559 |
| Flammpunkt | 173.7°C |
| Dampfdruck | 2.53E-10mmHg at 25°C |
| MSDS | |