ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50687-74-6 4-Octylphenyl-2-chlor-4-hydroxybenzoat |
|
| Produkt-Name | 4-Octylphenyl-2-chlor-4-hydroxybenzoat |
| Synonyme | 4-Octylphenyl-2-chlor-4-hydroxybenzoat; Benzoesäure, 2-Chlor-4-hydroxy-, 4-octylphenylester; |
| Englischer Name | 4-octylphenyl 2-chloro-4-hydroxybenzoate;4-Octylphenyl 2-chloro-4-hydroxybenzoate;benzoic acid, 2-chloro-4-hydroxy-, 4-octylphenyl ester |
| Molekulare Formel | C21H25ClO3 |
| Molecular Weight | 360.8744 |
| InChl | InChI=1/C21H25ClO3/c1-2-3-4-5-6-7-8-16-9-12-18(13-10-16)25-21(24)19-14-11-17(23)15-20(19)22/h9-15,23H,2-8H2,1H3 |
| CAS Registry Number | 50687-74-6 |
| Molecular Structure | ![]() |
| Dichte | 1.145g/cm3 |
| Siedepunkt | 507°C at 760 mmHg |
| Brechungsindex | 1.56 |
| Flammpunkt | 260.4°C |
| Dampfdruck | 6.68E-11mmHg at 25°C |
| MSDS | |