ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50694-82-1 4,6-dichlor-2-methylbenzol-1,3-diamin |
|
| Produkt-Name | 4,6-dichlor-2-methylbenzol-1,3-diamin |
| Synonyme | ; 1,3-Benzoldiamin, 4,6-Dichlor-2-methyl-; 4,6-Dichlor-2-methylbenzol-1,3-diamin; |
| Englischer Name | 4,6-dichloro-2-methylbenzene-1,3-diamine;1,3-benzenediamine, 4,6-dichloro-2-methyl-;4,6-Dichloro-2-methylbenzene-1,3-diamine |
| Molekulare Formel | C7H8Cl2N2 |
| Molecular Weight | 191.0578 |
| InChl | InChI=1/C7H8Cl2N2/c1-3-6(10)4(8)2-5(9)7(3)11/h2H,10-11H2,1H3 |
| CAS Registry Number | 50694-82-1 |
| Molecular Structure | ![]() |
| Dichte | 1.424g/cm3 |
| Siedepunkt | 324.8°C at 760 mmHg |
| Brechungsindex | 1.656 |
| Flammpunkt | 150.3°C |
| Dampfdruck | 0.000239mmHg at 25°C |
| MSDS | |