ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50807-15-3 4-(2-cyclohexyl-2-propyl)cyclohexan-1-ol |
|
| Produkt-Name | 4-(2-cyclohexyl-2-propyl)cyclohexan-1-ol |
| Englischer Name | 4-(2-cyclohexyl-2-propyl)cyclohexan-1-ol;4-(2-Cyclohexyl-2-propyl)cyclohexan-1-ol;4-(2-cyclohexylpropyl)cyclohexanol |
| Molekulare Formel | C15H28O |
| Molecular Weight | 224.3822 |
| InChl | InChI=1/C15H28O/c1-12(14-5-3-2-4-6-14)11-13-7-9-15(16)10-8-13/h12-16H,2-11H2,1H3 |
| CAS Registry Number | 50807-15-3 |
| EINECS | 256-771-0 |
| Molecular Structure | ![]() |
| Dichte | 0.942g/cm3 |
| Siedepunkt | 298°C at 760 mmHg |
| Brechungsindex | 1.489 |
| Flammpunkt | 124.9°C |
| Dampfdruck | 0.000132mmHg at 25°C |
| MSDS | |