ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51135-91-2 4-amino-2,3-dihydro-1H-inden-1-one |
|
| Produkt-Name | 4-amino-2,3-dihydro-1H-inden-1-one |
| Englischer Name | 4-amino-2,3-dihydro-1H-inden-1-one;1H-inden-1-one, 4-amino-2,3-dihydro-;4-Aminoindan-1-on;4-aminoindan-1-one;4-amino-1-indanone |
| Molekulare Formel | C9H9NO |
| Molecular Weight | 147.1739 |
| InChl | InChI=1/C9H9NO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5,10H2 |
| CAS Registry Number | 51135-91-2 |
| Molecular Structure | ![]() |
| Dichte | 1.255g/cm3 |
| Siedepunkt | 323.177°C at 760 mmHg |
| Brechungsindex | 1.65 |
| Flammpunkt | 149.252°C |
| Dampfdruck | 0mmHg at 25°C |
| MSDS | |