ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52664-16-1 4-(1-aminopropyl)-1-(1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-4-ol |
|
| Produkt-Name | 4-(1-aminopropyl)-1-(1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-4-ol |
| Englischer Name | 4-(1-aminopropyl)-1-(1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-4-ol; |
| Molekulare Formel | C18H28N2O |
| Molecular Weight | 288.4277 |
| InChl | InChI=1/C18H28N2O/c1-2-17(19)18(21)9-11-20(12-10-18)16-8-7-14-5-3-4-6-15(14)13-16/h3-6,16-17,21H,2,7-13,19H2,1H3 |
| CAS Registry Number | 52664-16-1 |
| Molecular Structure | ![]() |
| Dichte | 1.115g/cm3 |
| Siedepunkt | 454.4°C at 760 mmHg |
| Brechungsindex | 1.584 |
| Flammpunkt | 228.6°C |
| Dampfdruck | 4.77E-09mmHg at 25°C |
| MSDS | |