ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52896-89-6 4-Ethyl-3-methylheptan |
|
| Produkt-Name | 4-Ethyl-3-methylheptan |
| Synonyme | ; 4-Ethyl-3-methylheptan; Heptan, 4-ethyl-3-methyl-; |
| Englischer Name | 4-ethyl-3-methylheptane;4-Ethyl-3-methylheptane;heptane, 4-ethyl-3-methyl- |
| Molekulare Formel | C10H22 |
| Molecular Weight | 142.2817 |
| InChl | InChI=1/C10H22/c1-5-8-10(7-3)9(4)6-2/h9-10H,5-8H2,1-4H3 |
| CAS Registry Number | 52896-89-6 |
| Molecular Structure | ![]() |
| Dichte | 0.732g/cm3 |
| Siedepunkt | 161.9°C at 760 mmHg |
| Brechungsindex | 1.411 |
| Flammpunkt | 84.9°C |
| Dampfdruck | 2.9mmHg at 25°C |
| MSDS | |