ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53032-89-6 4-Carbamidoyl-N-(3,4-dimethoxyphenyl)benzamid |
|
| Produkt-Name | 4-Carbamidoyl-N-(3,4-dimethoxyphenyl)benzamid |
| Synonyme | ; |
| Englischer Name | 4-carbamimidoyl-N-(3,4-dimethoxyphenyl)benzamide; |
| Molekulare Formel | C16H17N3O3 |
| Molecular Weight | 299.3245 |
| InChl | InChI=1/C16H17N3O3/c1-21-13-8-7-12(9-14(13)22-2)19-16(20)11-5-3-10(4-6-11)15(17)18/h3-9H,1-2H3,(H3,17,18)(H,19,20) |
| CAS Registry Number | 53032-89-6 |
| Molecular Structure | ![]() |
| Dichte | 1.24g/cm3 |
| Brechungsindex | 1.593 |
| MSDS | |