ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53220-41-0 4-(4-Chlorobenzoyl)piperidine |
|
| Produkt-Name | 4-(4-Chlorobenzoyl)piperidine |
| Englischer Name | 4-(4-Chlorobenzoyl)piperidine;(4-Chlorophenyl)(piperidin-4-yl)methanone;methanone, (4-chlorophenyl)-4-piperidinyl- |
| Molekulare Formel | C12H14ClNO |
| Molecular Weight | 223.6987 |
| InChl | InChI=1/C12H14ClNO/c13-11-3-1-9(2-4-11)12(15)10-5-7-14-8-6-10/h1-4,10,14H,5-8H2 |
| CAS Registry Number | 53220-41-0 |
| Molecular Structure | ![]() |
| Dichte | 1.168g/cm3 |
| Siedepunkt | 356.2°C at 760 mmHg |
| Brechungsindex | 1.549 |
| Flammpunkt | 169.2°C |
| Dampfdruck | 2.96E-05mmHg at 25°C |
| MSDS | |